2,4-dimethyl-3-isopropyl-2-pentene
CAS:<10412-42-7>
Formula:C10H20; 140.27 g/mol
InChiKey:MYOZFUVCYVFUPN-UHFFFAOYSA-N
SMILES:CC(C)C(C(C)C)=C(C)C
*
Density:0.768 g/mL
Molar volume:182.6 mL/mol
Refractive index:1.438
Molecular refractive power:47.92 mL/mol
Melting point:-55 °C
Boiling point:152 °C

Isomers

butylcyclohexane
*
tert-butylcyclohexane
*
2-tert-butyl-3,3-dimethyl-1-butene
*
2-tert-butyl-3-methyl-1-pentene
*
cyclodecane
*
(R)-2-cyclohexylbutane
*
2-cyclohexylbutane
*
1-cyclohexyl-2-methylpropane
*
1-cyclopentyl-3-methylbutane
*
2-cyclopentyl-2-methylbutane
*
2-cyclopentylpentane
*
3-cyclopentylpentane
*
1-decene
*
cis-5-decene
*
trans-5-decene
*
2,4-dimethyl-3-isopropyl-2-pentene
*
2,3-dimethyl-2-octene
*
2,4-dimethyl-2-octene
*
2,6-dimethyl-2-octene
*
2,7-dimethyl-2-octene
*
3,7-dimethyl-1-octene
*
d-2,5-dimethyl-2-octene
*
d-2,6-dimethyl-1-octene
*
d-2,6-dimethyl-2-octene
*
4,4-dimethyl-1-octene
*
7,7-dimethyl-1-octene
*
ethylcyclooctane
*
2-ethyl-4,4-dimethyl-1-hexene
*
2-isopropyl-3,3-dimethyl-1-pentene
*
cis-1-isopropyl-3-methylcyclohexane
*
trans-1-isopropyl-3-methylcyclohexane
*
cis-1-isopropyl-4-methylcyclohexane
*
trans-1-isopropyl-4-methylcyclohexane
*
2-isopropyl-5-methyl-1-hexene
*
2-methylnon-1-ene
*
5-methyl-4-nonene
*
1-methyl-1-propylcyclohexane
*
pentylcyclopentane
*
propylcycloheptane
*
4-propyl-3-heptene
*
1r,2c,3c,4c-tetramethylcyclohexane
*
1r,2c,3c,5c-tetramethylcyclohexane
*
1r,2c,4c,5c-tetramethylcyclohexane
*
1r,2c,3c,4t-tetramethylcyclohexane
*
1r,2c,3c,5t-tetramethylcyclohexane
*
1r,2c,4c,5t-tetramethylcyclohexane
*
1r,2c,3t,4c-1,2,3,4-tetramethylcyclohexane
*
1r,2c,3t,5c-tetramethylcyclohexane
*
1r,2c,3t,4t-tetramethylcyclohexane
*
1r,2c,3t,5t-tetramethylcyclohexane
*
1r,2c,4t,5t-tetramethylcyclohexane
*
1r,2t,3c,5c-tetramethylcyclohexane
*
1r,2t,3c,4t-tetramethylcyclohexane
*
1r,2t,3c,5t-tetramethylcyclohexane
*
1r,2t,4c,5t-tetramethylcyclohexane
*
1r,2t,3t,4c-tetramethylcyclohexane
*
1r,2t,4t,5c-tetramethylcyclohexane
*
1,1,3,3-tetramethylcyclohexane
*
2,3,4,4-tetramethylhex-1-ene
*
2,3,4,4-tetramethyl-2-hexene
*
2,3,5,5-tetramethyl-1-hexene
*
2,3,5,5-tetramethyl-2-hexene
*
2,4,4,5-tetramethyl-2-hexene
*
4,4,5,5-tetramethyl-1-hexene
*
1,1,2-trimethylcycloheptane
*
1,1,4-trimethylcycloheptane
*
2,4,4-trimethyl-2-heptene
*
2,4,6-trimethyl-3-heptene
*
3,3,6-trimethyl-1-heptene
*